ChemNet > CAS > 43020-12-8 1- [5- (4-klorofenil) -2-metil-3-furil] etan-1-satu
43020-12-8 1- [5- (4-klorofenil) -2-metil-3-furil] etan-1-satu
| Nama produk |
1- [5- (4-klorofenil) -2-metil-3-furil] etan-1-satu |
| Sinonim |
1- [5- (4-klorofenil) -2-metilfuran-3-yl] etanon |
| Nama bahasa Inggris |
1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one;1-[5-(4-chlorophenyl)-2-methylfuran-3-yl]ethanone |
| MF |
C13H11ClO2 |
| Berat Molekul |
234.6782 |
| InChI |
InChI=1/C13H11ClO2/c1-8(15)12-7-13(16-9(12)2)10-3-5-11(14)6-4-10/h3-7H,1-2H3 |
| CAS NO |
43020-12-8 |
| Struktur Molekul |
|
| Kepadatan |
1.189g/cm3 |
| Titik lebur |
114℃ |
| Titik didih |
346.1°C at 760 mmHg |
| Indeks bias |
1.55 |
| Titik nyala |
163.1°C |
| Tekanan uap |
5.88E-05mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|